C35H58O — CID 88794076
(14E,18E,22E)-2,6,10,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-12-ol (PubChem CID 88794076) has the molecular formula C35H58O and a molecular weight of 494.85 g/mol. Its IUPAC name is (14E,18E,22E)-2,6,10,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-12-ol.
| Compound Name | (14E,18E,22E)-2,6,10,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-12-ol |
|---|---|
| PubChem CID | 88794076 |
| Molecular Formula | C35H58O |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.45 |
| IUPAC Name | (14E,18E,22E)-2,6,10,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-12-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(O)C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C35H58O/c1-28(2)15-10-17-30(5)19-12-20-32(7)21-13-23-33(8)25-26-35(36)27-34(9)24-14-22-31(6)18-11-16-29(3)4/h15-16,19,21-22,25,27,35-36H,10-14,17-18,20,23-24,26H2,1-9H3/b30-19+,31-22?,32-21+,33-25+,34-27? |
| InChIKey | DOHHQHDOFRYWCE-RCDNBHTCSA-N |
| XLogP | 11.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|