C20H33Br — CID 54461369
8-bromo-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene (PubChem CID 54461369) has the molecular formula C20H33Br and a molecular weight of 353.39 g/mol. Its IUPAC name is 8-bromo-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene.
| Compound Name | 8-bromo-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 54461369 |
| Molecular Formula | C20H33Br |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 8-bromo-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
| SMILES | CC(C)=CCCC(C)=CCC(Br)C=C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H33Br/c1-16(2)9-7-11-18(5)13-14-20(21)15-19(6)12-8-10-17(3)4/h9-10,13,15,20H,7-8,11-12,14H2,1-6H3 |
| InChIKey | XBVSRZUOCYTXRB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|