C22H35ClO — CID 57090053
3-(2,6-dimethylhepta-1,5-dienyl)-6,10-dimethylundeca-5,9-dienoyl chloride (PubChem CID 57090053) has the molecular formula C22H35ClO and a molecular weight of 350.97 g/mol. Its IUPAC name is 3-(2,6-dimethylhepta-1,5-dienyl)-6,10-dimethylundeca-5,9-dienoyl chloride.
| Compound Name | 3-(2,6-dimethylhepta-1,5-dienyl)-6,10-dimethylundeca-5,9-dienoyl chloride |
|---|---|
| PubChem CID | 57090053 |
| Molecular Formula | C22H35ClO |
| Molecular Weight | 350.97 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 3-(2,6-dimethylhepta-1,5-dienyl)-6,10-dimethylundeca-5,9-dienoyl chloride |
| SMILES | CC(C)=CCCC(C)=CCC(C=C(C)CCC=C(C)C)CC(=O)Cl |
| InChI | InChI=1S/C22H35ClO/c1-17(2)9-7-11-19(5)13-14-21(16-22(23)24)15-20(6)12-8-10-18(3)4/h9-10,13,15,21H,7-8,11-12,14,16H2,1-6H3 |
| InChIKey | XDXRRBIRDANGNA-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.97 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|