C23H40O — CID 87169768
(6E)-4-[(1E)-2,6-dimethylhepta-1,5-dienyl]-7,11-dimethyldodeca-6,10-dien-2-ol (PubChem CID 87169768) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is (6E)-4-[(1E)-2,6-dimethylhepta-1,5-dienyl]-7,11-dimethyldodeca-6,10-dien-2-ol.
| Compound Name | (6E)-4-[(1E)-2,6-dimethylhepta-1,5-dienyl]-7,11-dimethyldodeca-6,10-dien-2-ol |
|---|---|
| PubChem CID | 87169768 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | (6E)-4-[(1E)-2,6-dimethylhepta-1,5-dienyl]-7,11-dimethyldodeca-6,10-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)CC(C)O |
| InChI | InChI=1S/C23H40O/c1-18(2)10-8-12-20(5)14-15-23(17-22(7)24)16-21(6)13-9-11-19(3)4/h10-11,14,16,22-24H,8-9,12-13,15,17H2,1-7H3/b20-14+,21-16+ |
| InChIKey | GDUJRYJRTZCXSU-QUFKBVBHSA-N |
| XLogP | 7.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|