C14H26 — CID 174724877
(6E)-8-ethyl-2,6-dimethyldeca-2,6-diene (PubChem CID 174724877) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (6E)-8-ethyl-2,6-dimethyldeca-2,6-diene.
| Compound Name | (6E)-8-ethyl-2,6-dimethyldeca-2,6-diene |
|---|---|
| PubChem CID | 174724877 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (6E)-8-ethyl-2,6-dimethyldeca-2,6-diene |
| SMILES | CCC(/C=C(\C)CCC=C(C)C)CC |
| InChI | InChI=1S/C14H26/c1-6-14(7-2)11-13(5)10-8-9-12(3)4/h9,11,14H,6-8,10H2,1-5H3/b13-11+ |
| InChIKey | VRNCCQIVCSTAIB-ACCUITESSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|