C18H30O — CID 10890690
(4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-ol (PubChem CID 10890690) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-ol.
| Compound Name | (4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-ol |
|---|---|
| PubChem CID | 10890690 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-ol |
| SMILES | C=CC[C@@H](O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H30O/c1-6-9-18(19)14-17(5)13-8-12-16(4)11-7-10-15(2)3/h6,10,12,14,18-19H,1,7-9,11,13H2,2-5H3/b16-12+,17-14+/t18-/m1/s1 |
| InChIKey | HGTACVRZXOJDCB-MKFKDMEFSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|