C33H56O — CID 54034221
6,10,14-trimethyl-3-(3,7,11-trimethyldodeca-2,6,10-trienyl)pentadeca-5,9,13-trien-1-ol (PubChem CID 54034221) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol. Its IUPAC name is 6,10,14-trimethyl-3-(3,7,11-trimethyldodeca-2,6,10-trienyl)pentadeca-5,9,13-trien-1-ol.
| Compound Name | 6,10,14-trimethyl-3-(3,7,11-trimethyldodeca-2,6,10-trienyl)pentadeca-5,9,13-trien-1-ol |
|---|---|
| PubChem CID | 54034221 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | 6,10,14-trimethyl-3-(3,7,11-trimethyldodeca-2,6,10-trienyl)pentadeca-5,9,13-trien-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(CC=C(C)CCC=C(C)CCC=C(C)C)CCO |
| InChI | InChI=1S/C33H56O/c1-27(2)13-9-15-29(5)17-11-19-31(7)21-23-33(25-26-34)24-22-32(8)20-12-18-30(6)16-10-14-28(3)4/h13-14,17-18,21-22,33-34H,9-12,15-16,19-20,23-26H2,1-8H3 |
| InChIKey | LHTLQUDOTGHACD-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|