C17H30O — CID 5362831
(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol (PubChem CID 5362831) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol.
| Compound Name | (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol |
|---|---|
| PubChem CID | 5362831 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCO |
| InChI | InChI=1S/C17H30O/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18/h9-10,13,18H,5-8,11-12,14H2,1-4H3/b16-10+,17-13+ |
| InChIKey | XEFQCLXNSJBVNZ-QKXOVSGLSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|