C23H40O2 — CID 67790296
cyclopropyloxycyclopropane;(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol (PubChem CID 67790296) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is cyclopropyloxycyclopropane;(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol.
| Compound Name | cyclopropyloxycyclopropane;(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol |
|---|---|
| PubChem CID | 67790296 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | cyclopropyloxycyclopropane;(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol |
| SMILES | C1CC1OC1CC1.CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCO |
| InChI | InChI=1S/C17H30O.C6H10O/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18;1-2-5(1)7-6-3-4-6/h9-10,13,18H,5-8,11-12,14H2,1-4H3;5-6H,1-4H2/b16-10+,17-13+; |
| InChIKey | LBVSNYUMPLEVDR-JFNHKWSOSA-N |
| XLogP | 6.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|