C20H36O2 — CID 57281469
14-(ethoxymethoxy)-2,6,10-trimethyltetradeca-2,6,10-triene (PubChem CID 57281469) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 14-(ethoxymethoxy)-2,6,10-trimethyltetradeca-2,6,10-triene.
| Compound Name | 14-(ethoxymethoxy)-2,6,10-trimethyltetradeca-2,6,10-triene |
|---|---|
| PubChem CID | 57281469 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 14-(ethoxymethoxy)-2,6,10-trimethyltetradeca-2,6,10-triene |
| SMILES | CCOCOCCCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H36O2/c1-6-21-17-22-16-8-7-12-19(4)14-10-15-20(5)13-9-11-18(2)3/h11-12,15H,6-10,13-14,16-17H2,1-5H3 |
| InChIKey | IEGGAJXQMVAANR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|