C32H54O — CID 174355768
2,6,10-trimethyl-13-(4,8,12-trimethyltrideca-3,7,11-trienoxy)trideca-2,6,10-triene (PubChem CID 174355768) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is 2,6,10-trimethyl-13-(4,8,12-trimethyltrideca-3,7,11-trienoxy)trideca-2,6,10-triene.
| Compound Name | 2,6,10-trimethyl-13-(4,8,12-trimethyltrideca-3,7,11-trienoxy)trideca-2,6,10-triene |
|---|---|
| PubChem CID | 174355768 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | 2,6,10-trimethyl-13-(4,8,12-trimethyltrideca-3,7,11-trienoxy)trideca-2,6,10-triene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCOCCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C32H54O/c1-27(2)15-9-17-29(5)19-11-21-31(7)23-13-25-33-26-14-24-32(8)22-12-20-30(6)18-10-16-28(3)4/h15-16,19-20,23-24H,9-14,17-18,21-22,25-26H2,1-8H3 |
| InChIKey | TUNFFRBINYBRJJ-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|