C24H42O3 — CID 118913633
3-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)propane-1,2-diol (PubChem CID 118913633) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 3-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)propane-1,2-diol.
| Compound Name | 3-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 118913633 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 3-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)propane-1,2-diol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCOCC(O)CO |
| InChI | InChI=1S/C24H42O3/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)16-9-17-27-19-24(26)18-25/h10,12,14,16,24-26H,6-9,11,13,15,17-19H2,1-5H3 |
| InChIKey | KBVAZLPTKZCJAI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|