C25H44O4 — CID 141426027
(2R,3S)-4-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)butane-1,2,3-triol (PubChem CID 141426027) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (2R,3S)-4-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)butane-1,2,3-triol.
| Compound Name | (2R,3S)-4-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)butane-1,2,3-triol |
|---|---|
| PubChem CID | 141426027 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (2R,3S)-4-(4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenoxy)butane-1,2,3-triol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCOC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C25H44O4/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)16-9-17-29-19-25(28)24(27)18-26/h10,12,14,16,24-28H,6-9,11,13,15,17-19H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | FQHYSPZLUPVMBZ-RPBOFIJWSA-N |
| XLogP | 5.25 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|