C20H40O3 — CID 75995743
3-(5,9,13-trimethyltetradec-4-enoxy)propane-1,2-diol (PubChem CID 75995743) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is 3-(5,9,13-trimethyltetradec-4-enoxy)propane-1,2-diol.
| Compound Name | 3-(5,9,13-trimethyltetradec-4-enoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 75995743 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 3-(5,9,13-trimethyltetradec-4-enoxy)propane-1,2-diol |
| SMILES | CC(=CCCCOCC(O)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H40O3/c1-17(2)9-7-11-19(4)13-8-12-18(3)10-5-6-14-23-16-20(22)15-21/h10,17,19-22H,5-9,11-16H2,1-4H3 |
| InChIKey | CFYKCOOCJPQVMY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|