C22H44O5 — CID 89051803
(2R,3S,4S)-5-[(E)-5,9,13-trimethyltetradec-4-enoxy]pentane-1,2,3,4-tetrol (PubChem CID 89051803) has the molecular formula C22H44O5 and a molecular weight of 388.59 g/mol. Its IUPAC name is (2R,3S,4S)-5-[(E)-5,9,13-trimethyltetradec-4-enoxy]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S)-5-[(E)-5,9,13-trimethyltetradec-4-enoxy]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 89051803 |
| Molecular Formula | C22H44O5 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | (2R,3S,4S)-5-[(E)-5,9,13-trimethyltetradec-4-enoxy]pentane-1,2,3,4-tetrol |
| SMILES | C/C(=C\CCCOC[C@H](O)[C@@H](O)[C@H](O)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H44O5/c1-17(2)9-7-11-19(4)13-8-12-18(3)10-5-6-14-27-16-21(25)22(26)20(24)15-23/h10,17,19-26H,5-9,11-16H2,1-4H3/b18-10+/t19?,20-,21+,22+/m1/s1 |
| InChIKey | WPIRKOQKBCHUPW-YIGFJLHJSA-N |
| XLogP | 3.44 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|