C26H50O6 — CID 89051911
(3R,4S,5R)-3,4,5,6-tetrahydroxy-1-[(E)-3,7,11,15-tetramethylhexadec-2-enoxy]hexan-2-one (PubChem CID 89051911) has the molecular formula C26H50O6 and a molecular weight of 458.68 g/mol. Its IUPAC name is (3R,4S,5R)-3,4,5,6-tetrahydroxy-1-[(E)-3,7,11,15-tetramethylhexadec-2-enoxy]hexan-2-one.
| Compound Name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-1-[(E)-3,7,11,15-tetramethylhexadec-2-enoxy]hexan-2-one |
|---|---|
| PubChem CID | 89051911 |
| Molecular Formula | C26H50O6 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-1-[(E)-3,7,11,15-tetramethylhexadec-2-enoxy]hexan-2-one |
| SMILES | C/C(=C\COCC(=O)[C@H](O)[C@@H](O)[C@H](O)CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H50O6/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)15-16-32-18-24(29)26(31)25(30)23(28)17-27/h15,19-21,23,25-28,30-31H,6-14,16-18H2,1-5H3/b22-15+/t20?,21?,23-,25+,26+/m1/s1 |
| InChIKey | OSBJEHJLJMUIMD-MNUVPLLLSA-N |
| XLogP | 4.03 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|