C28H52O7 — CID 89051937
[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (E)-5,9,13,17-tetramethyloctadec-4-enoate (PubChem CID 89051937) has the molecular formula C28H52O7 and a molecular weight of 500.72 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (E)-5,9,13,17-tetramethyloctadec-4-enoate.
| Compound Name | [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (E)-5,9,13,17-tetramethyloctadec-4-enoate |
|---|---|
| PubChem CID | 89051937 |
| Molecular Formula | C28H52O7 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (E)-5,9,13,17-tetramethyloctadec-4-enoate |
| SMILES | C/C(=C\CCC(=O)OCC(=O)[C@H](O)[C@@H](O)[C@H](O)CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C28H52O7/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)16-9-17-26(32)35-19-25(31)28(34)27(33)24(30)18-29/h16,20-22,24,27-30,33-34H,6-15,17-19H2,1-5H3/b23-16+/t21?,22?,24-,27+,28+/m1/s1 |
| InChIKey | YMVZMSVUGONFJD-FVTDVRKVSA-N |
| XLogP | 4.34 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|