C24H46O3 — CID 175351685
1,2-dihydroxy-7,11,15,19-tetramethylicos-6-en-3-one (PubChem CID 175351685) has the molecular formula C24H46O3 and a molecular weight of 382.63 g/mol. Its IUPAC name is 1,2-dihydroxy-7,11,15,19-tetramethylicos-6-en-3-one.
| Compound Name | 1,2-dihydroxy-7,11,15,19-tetramethylicos-6-en-3-one |
|---|---|
| PubChem CID | 175351685 |
| Molecular Formula | C24H46O3 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.34 |
| IUPAC Name | 1,2-dihydroxy-7,11,15,19-tetramethylicos-6-en-3-one |
| SMILES | CC(=CCCC(=O)C(O)CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H46O3/c1-19(2)10-6-11-20(3)12-7-13-21(4)14-8-15-22(5)16-9-17-23(26)24(27)18-25/h16,19-21,24-25,27H,6-15,17-18H2,1-5H3 |
| InChIKey | IQTZTNZMJKNWOC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|