C25H48O3 — CID 175386593
3,3-dihydroxy-8,12,16,20-tetramethylhenicos-7-en-4-one (PubChem CID 175386593) has the molecular formula C25H48O3 and a molecular weight of 396.66 g/mol. Its IUPAC name is 3,3-dihydroxy-8,12,16,20-tetramethylhenicos-7-en-4-one.
| Compound Name | 3,3-dihydroxy-8,12,16,20-tetramethylhenicos-7-en-4-one |
|---|---|
| PubChem CID | 175386593 |
| Molecular Formula | C25H48O3 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.36 |
| IUPAC Name | 3,3-dihydroxy-8,12,16,20-tetramethylhenicos-7-en-4-one |
| SMILES | CCC(O)(O)C(=O)CCC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H48O3/c1-7-25(27,28)24(26)19-11-18-23(6)17-10-16-22(5)15-9-14-21(4)13-8-12-20(2)3/h18,20-22,27-28H,7-17,19H2,1-6H3 |
| InChIKey | MFJAMRVZOYHLRC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|