C22H43NO — CID 88939219
(E)-5,9,13,17-tetramethyl-1-nitrosooctadec-4-ene (PubChem CID 88939219) has the molecular formula C22H43NO and a molecular weight of 337.59 g/mol. Its IUPAC name is (E)-5,9,13,17-tetramethyl-1-nitrosooctadec-4-ene.
| Compound Name | (E)-5,9,13,17-tetramethyl-1-nitrosooctadec-4-ene |
|---|---|
| PubChem CID | 88939219 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | (E)-5,9,13,17-tetramethyl-1-nitrosooctadec-4-ene |
| SMILES | C/C(=C\CCCN=O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H43NO/c1-19(2)11-8-13-21(4)15-10-17-22(5)16-9-14-20(3)12-6-7-18-23-24/h12,19,21-22H,6-11,13-18H2,1-5H3/b20-12+ |
| InChIKey | ZMAKJAVLXZPDTR-UDWIEESQSA-N |
| XLogP | 7.92 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|