C20H38O — CID 54256190
(7R,11R)-3,7,11,15-tetramethylhexadec-2-enal (PubChem CID 54256190) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is (7R,11R)-3,7,11,15-tetramethylhexadec-2-enal.
| Compound Name | (7R,11R)-3,7,11,15-tetramethylhexadec-2-enal |
|---|---|
| PubChem CID | 54256190 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | (7R,11R)-3,7,11,15-tetramethylhexadec-2-enal |
| SMILES | CC(=CC=O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H38O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15-19H,6-14H2,1-5H3/t18-,19-/m1/s1 |
| InChIKey | RAFZYSUICBQABU-RTBURBONSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|