C20H38K2O2 — CID 170924185
CID 170924185 (PubChem CID 170924185) has the molecular formula C20H38K2O2 and a molecular weight of 388.72 g/mol.
| Compound Name | CID 170924185 |
|---|---|
| PubChem CID | 170924185 |
| Molecular Formula | C20H38K2O2 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | — |
| SMILES | CC(=CC(=O)O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.[K].[K] |
| InChI | InChI=1S/C20H38O2.2K/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22;;/h15-18H,6-14H2,1-5H3,(H,21,22);;/t17-,18-;;/m1../s1 |
| InChIKey | CYAFCOHNLFRWBJ-RKDOVGOJSA-N |
| XLogP | 5.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|