C24H47NO3 — CID 54096321
N,N-bis(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide (PubChem CID 54096321) has the molecular formula C24H47NO3 and a molecular weight of 397.64 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide |
|---|---|
| PubChem CID | 54096321 |
| Molecular Formula | C24H47NO3 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.36 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3,7,11,15-tetramethylhexadec-2-enamide |
| SMILES | CC(=CC(=O)N(CCO)CCO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H47NO3/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)19-24(28)25(15-17-26)16-18-27/h19-22,26-27H,6-18H2,1-5H3 |
| InChIKey | MXJIEAJJDDUWQP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|