C20H42GeO2 — CID 174380036
germane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid (PubChem CID 174380036) has the molecular formula C20H42GeO2 and a molecular weight of 387.16 g/mol. Its IUPAC name is germane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid.
| Compound Name | germane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid |
|---|---|
| PubChem CID | 174380036 |
| Molecular Formula | C20H42GeO2 |
| Molecular Weight | 387.16 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | germane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.[GeH4] |
| InChI | InChI=1S/C20H38O2.GeH4/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22;/h15-18H,6-14H2,1-5H3,(H,21,22);1H4/b19-15+;/t17-,18-;/m1./s1 |
| InChIKey | LTWZAJRADMLGKM-YCNCEQBRSA-N |
| XLogP | 5.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.16 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|