C20H38BrLiO2 — CID 174970117
lithium;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid;bromide (PubChem CID 174970117) has the molecular formula C20H38BrLiO2 and a molecular weight of 397.37 g/mol. Its IUPAC name is lithium;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid;bromide.
| Compound Name | lithium;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid;bromide |
|---|---|
| PubChem CID | 174970117 |
| Molecular Formula | C20H38BrLiO2 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | lithium;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoic acid;bromide |
| SMILES | C/C(=C\C(=O)O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.[Br-].[Li+] |
| InChI | InChI=1S/C20H38O2.BrH.Li/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22;;/h15-18H,6-14H2,1-5H3,(H,21,22);1H;/q;;+1/p-1/b19-15+;;/t17-,18-;;/m1../s1 |
| InChIKey | GXHRDDGZGNIHQR-MVMUQCOPSA-M |
| XLogP | 0.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|