C24H44O2 — CID 57023975
4-hydroxy-7,11,15,19-tetramethylicosa-2,6-dien-5-one (PubChem CID 57023975) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is 4-hydroxy-7,11,15,19-tetramethylicosa-2,6-dien-5-one.
| Compound Name | 4-hydroxy-7,11,15,19-tetramethylicosa-2,6-dien-5-one |
|---|---|
| PubChem CID | 57023975 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 4-hydroxy-7,11,15,19-tetramethylicosa-2,6-dien-5-one |
| SMILES | CC=CC(O)C(=O)C=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H44O2/c1-7-11-23(25)24(26)18-22(6)17-10-16-21(5)15-9-14-20(4)13-8-12-19(2)3/h7,11,18-21,23,25H,8-10,12-17H2,1-6H3 |
| InChIKey | DVSADQBNDUODMY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|