C29H48O3 — CID 137412886
(E)-1-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-one (PubChem CID 137412886) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (E)-1-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-one.
| Compound Name | (E)-1-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-one |
|---|---|
| PubChem CID | 137412886 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (E)-1-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-one |
| SMILES | C/C(=C\C(=O)c1c(C)c(O)c(C)c(C)c1O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C29H48O3/c1-19(2)12-9-13-20(3)14-10-15-21(4)16-11-17-22(5)18-26(30)27-25(8)28(31)23(6)24(7)29(27)32/h18-21,31-32H,9-17H2,1-8H3/b22-18+ |
| InChIKey | SVBGUPWBYHVBHD-RELWKKBWSA-N |
| XLogP | 8.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|