C29H50OS — CID 54410535
2,3,4-trimethyl-6-sulfanyl-5-(3,7,11,15-tetramethylhexadec-2-enyl)phenol (PubChem CID 54410535) has the molecular formula C29H50OS and a molecular weight of 446.79 g/mol. Its IUPAC name is 2,3,4-trimethyl-6-sulfanyl-5-(3,7,11,15-tetramethylhexadec-2-enyl)phenol.
| Compound Name | 2,3,4-trimethyl-6-sulfanyl-5-(3,7,11,15-tetramethylhexadec-2-enyl)phenol |
|---|---|
| PubChem CID | 54410535 |
| Molecular Formula | C29H50OS |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 2,3,4-trimethyl-6-sulfanyl-5-(3,7,11,15-tetramethylhexadec-2-enyl)phenol |
| SMILES | CC(=CCc1c(C)c(C)c(C)c(O)c1S)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C29H50OS/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)18-19-27-25(7)24(6)26(8)28(30)29(27)31/h18,20-22,30-31H,9-17,19H2,1-8H3 |
| InChIKey | VTUQUBRFFWFAKF-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|