C31H47O2- — CID 102119808
4-hydroxy-2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-olate (PubChem CID 102119808) has the molecular formula C31H47O2- and a molecular weight of 451.72 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-olate.
| Compound Name | 4-hydroxy-2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-olate |
|---|---|
| PubChem CID | 102119808 |
| Molecular Formula | C31H47O2- |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 451.36 |
| IUPAC Name | 4-hydroxy-2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-olate |
| SMILES | C/C(=C\Cc1c(C)c([O-])c2ccccc2c1O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C31H48O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24,32-33H,9-17,21H2,1-6H3/p-1/b25-20+ |
| InChIKey | BUFJIHPUGZHTHL-LKUDQCMESA-M |
| XLogP | 8.86 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|