C56H100O2 — CID 657021
2-methyl-3-(3,7,11,15,19,23,27,31,35-nonamethylhexatriacontyl)naphthalene-1,4-diol (PubChem CID 657021) has the molecular formula C56H100O2 and a molecular weight of 805.41 g/mol. Its IUPAC name is 2-methyl-3-(3,7,11,15,19,23,27,31,35-nonamethylhexatriacontyl)naphthalene-1,4-diol.
| Compound Name | 2-methyl-3-(3,7,11,15,19,23,27,31,35-nonamethylhexatriacontyl)naphthalene-1,4-diol |
|---|---|
| PubChem CID | 657021 |
| Molecular Formula | C56H100O2 |
| Molecular Weight | 805.41 g/mol |
| Exact Mass | 804.77 |
| IUPAC Name | 2-methyl-3-(3,7,11,15,19,23,27,31,35-nonamethylhexatriacontyl)naphthalene-1,4-diol |
| SMILES | Cc1c(CCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C56H100O2/c1-42(2)22-14-23-43(3)24-15-25-44(4)26-16-27-45(5)28-17-29-46(6)30-18-31-47(7)32-19-33-48(8)34-20-35-49(9)36-21-37-50(10)40-41-52-51(11)55(57)53-38-12-13-39-54(53)56(52)58/h12-13,38-39,42-50,57-58H,14-37,40-41H2,1-11H3 |
| InChIKey | PDKXWSQLBMDZHO-UHFFFAOYSA-N |
| XLogP | 18.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.41 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|