C21H22O2 — CID 90810234
2-methyl-3-[(4-propan-2-ylphenyl)methyl]naphthalene-1,4-diol (PubChem CID 90810234) has the molecular formula C21H22O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-methyl-3-[(4-propan-2-ylphenyl)methyl]naphthalene-1,4-diol.
| Compound Name | 2-methyl-3-[(4-propan-2-ylphenyl)methyl]naphthalene-1,4-diol |
|---|---|
| PubChem CID | 90810234 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-methyl-3-[(4-propan-2-ylphenyl)methyl]naphthalene-1,4-diol |
| SMILES | Cc1c(Cc2ccc(C(C)C)cc2)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C21H22O2/c1-13(2)16-10-8-15(9-11-16)12-19-14(3)20(22)17-6-4-5-7-18(17)21(19)23/h4-11,13,22-23H,12H2,1-3H3 |
| InChIKey | XEYRZQXLFBRZFH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|