C14H16O6S — CID 174454080
2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid (PubChem CID 174454080) has the molecular formula C14H16O6S and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid.
| Compound Name | 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid |
|---|---|
| PubChem CID | 174454080 |
| Molecular Formula | C14H16O6S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid |
| SMILES | C=CCc1c(C)c(O)c2ccccc2c1O.O=S(=O)(O)O |
| InChI | InChI=1S/C14H14O2.H2O4S/c1-3-6-10-9(2)13(15)11-7-4-5-8-12(11)14(10)16;1-5(2,3)4/h3-5,7-8,15-16H,1,6H2,2H3;(H2,1,2,3,4) |
| InChIKey | JDZUSWFCCONYJC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|