2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid

C14H16O6S — CID 174454080

IUPAC2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid
SMILESC=CCc1c(C)c(O)c2ccccc2c1O.O=S(=O)(O)O
InChIInChI=1S/C14H14O2.H2O4S/c1-3-6-10-9(2)13(15)11-7-4-5-8-12(11)14(10)16;1-5(2,3)4/h3-5,7-8,15-16H,1,6H2,2H3;(H2,1,2,3,4)
InChIKeyJDZUSWFCCONYJC-UHFFFAOYSA-N
MW312.34 g/mol
LogP2.64
Rot. Bonds2

About 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid

2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid (PubChem CID 174454080) has the molecular formula C14H16O6S and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid.

Molecular Properties

Compound Name2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid
PubChem CID174454080
Molecular FormulaC14H16O6S
Molecular Weight312.34 g/mol
Exact Mass312.07
IUPAC Name2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid
SMILESC=CCc1c(C)c(O)c2ccccc2c1O.O=S(=O)(O)O
InChIInChI=1S/C14H14O2.H2O4S/c1-3-6-10-9(2)13(15)11-7-4-5-8-12(11)14(10)16;1-5(2,3)4/h3-5,7-8,15-16H,1,6H2,2H3;(H2,1,2,3,4)
InChIKeyJDZUSWFCCONYJC-UHFFFAOYSA-N
XLogP2.64
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.34
LogP ≤ 52.64
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid?
The IUPAC name of 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid (CID 174454080) is 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid.
What is the SMILES notation for 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid?
The canonical SMILES for 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid is C=CCc1c(C)c(O)c2ccccc2c1O.O=S(=O)(O)O.
What is the InChIKey of 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid?
The InChIKey is JDZUSWFCCONYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.H2O4S/c1-3-6-10-9(2)13(15)11-7-4-5-8-12(11)14(10)16;1-5(2,3)4/h3-5,7-8,15-16H,1,6H2,2H3;(H2,1,2,3,4).
What are the key properties of 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid?
2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid has a molecular weight of 312.34 g/mol, XLogP of 2.64, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-prop-2-enylnaphthalene-1,4-diol;sulfuric acid is sourced from PubChem (CID 174454080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).