C34H46O2 — CID 163410132
2-methyl-3-[(2E,6E,10E,14E)-3,7,11,15-tetramethylnonadeca-2,6,10,14,18-pentaenyl]naphthalene-1,4-diol (PubChem CID 163410132) has the molecular formula C34H46O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is 2-methyl-3-[(2E,6E,10E,14E)-3,7,11,15-tetramethylnonadeca-2,6,10,14,18-pentaenyl]naphthalene-1,4-diol.
| Compound Name | 2-methyl-3-[(2E,6E,10E,14E)-3,7,11,15-tetramethylnonadeca-2,6,10,14,18-pentaenyl]naphthalene-1,4-diol |
|---|---|
| PubChem CID | 163410132 |
| Molecular Formula | C34H46O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 2-methyl-3-[(2E,6E,10E,14E)-3,7,11,15-tetramethylnonadeca-2,6,10,14,18-pentaenyl]naphthalene-1,4-diol |
| SMILES | C=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1c(C)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C34H46O2/c1-7-8-14-25(2)15-11-16-26(3)17-12-18-27(4)19-13-20-28(5)23-24-30-29(6)33(35)31-21-9-10-22-32(31)34(30)36/h7,9-10,15,17,19,21-23,35-36H,1,8,11-14,16,18,20,24H2,2-6H3/b25-15+,26-17+,27-19+,28-23+ |
| InChIKey | PVMRGZSQWCJCGB-OJTCNYPGSA-N |
| XLogP | 10.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|