C27H40O4 — CID 172636036
2,3-dimethoxy-5-methyl-6-[(2E,6E,10E)-3,7,11-trimethylpentadeca-2,6,10,14-tetraenyl]benzene-1,4-diol (PubChem CID 172636036) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E)-3,7,11-trimethylpentadeca-2,6,10,14-tetraenyl]benzene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E)-3,7,11-trimethylpentadeca-2,6,10,14-tetraenyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 172636036 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E)-3,7,11-trimethylpentadeca-2,6,10,14-tetraenyl]benzene-1,4-diol |
| SMILES | C=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1c(C)c(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C27H40O4/c1-8-9-12-19(2)13-10-14-20(3)15-11-16-21(4)17-18-23-22(5)24(28)26(30-6)27(31-7)25(23)29/h8,13,15,17,28-29H,1,9-12,14,16,18H2,2-7H3/b19-13+,20-15+,21-17+ |
| InChIKey | VGILSPCSAPPART-JYQWTDEISA-N |
| XLogP | 7.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|