C24H36O4 — CID 10992743
2,3-dimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,4-diol (PubChem CID 10992743) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 10992743 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,4-diol |
| SMILES | COc1c(O)c(C)c(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(O)c1OC |
| InChI | InChI=1S/C24H36O4/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-20-19(5)21(25)23(27-6)24(28-7)22(20)26/h10,12,14,25-26H,8-9,11,13,15H2,1-7H3/b17-12+,18-14+ |
| InChIKey | CJEFSXQNNAAJQZ-NXGXIAAHSA-N |
| XLogP | 6.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|