C26H40O2 — CID 89245870
1,2-dimethoxy-3,4,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene (PubChem CID 89245870) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 1,2-dimethoxy-3,4,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene.
| Compound Name | 1,2-dimethoxy-3,4,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene |
|---|---|
| PubChem CID | 89245870 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 1,2-dimethoxy-3,4,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene |
| SMILES | COc1c(C)c(C)c(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(C)c1OC |
| InChI | InChI=1S/C26H40O2/c1-18(2)12-10-13-19(3)14-11-15-20(4)16-17-24-21(5)22(6)25(27-8)26(28-9)23(24)7/h12,14,16H,10-11,13,15,17H2,1-9H3/b19-14+,20-16+ |
| InChIKey | VWOHCNMOTHRZBK-XHGFWWIISA-N |
| XLogP | 7.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|