C31H48O4 — CID 154815659
2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14E)-3,7,11,15-tetramethyloctadeca-2,6,10,14-tetraenyl]benzene-1,4-diol (PubChem CID 154815659) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14E)-3,7,11,15-tetramethyloctadeca-2,6,10,14-tetraenyl]benzene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14E)-3,7,11,15-tetramethyloctadeca-2,6,10,14-tetraenyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 154815659 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14E)-3,7,11,15-tetramethyloctadeca-2,6,10,14-tetraenyl]benzene-1,4-diol |
| SMILES | CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C\CC/C(C)=C/Cc1c(C)c(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C31H48O4/c1-9-13-22(2)14-10-15-23(3)16-11-17-24(4)18-12-19-25(5)20-21-27-26(6)28(32)30(34-7)31(35-8)29(27)33/h14,16,18,20,32-33H,9-13,15,17,19,21H2,1-8H3/b22-14+,23-16+,24-18-,25-20+ |
| InChIKey | WYVMSDOOEXKBCB-LBKBZBAISA-N |
| XLogP | 8.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|