C28H42O4 — CID 171662232
2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14Z)-3,7,11-trimethylhexadeca-2,6,10,14-tetraenyl]benzene-1,4-diol (PubChem CID 171662232) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14Z)-3,7,11-trimethylhexadeca-2,6,10,14-tetraenyl]benzene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14Z)-3,7,11-trimethylhexadeca-2,6,10,14-tetraenyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 171662232 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(2E,6Z,10E,14Z)-3,7,11-trimethylhexadeca-2,6,10,14-tetraenyl]benzene-1,4-diol |
| SMILES | C/C=C\CC/C(C)=C/CC/C(C)=C\CC/C(C)=C/Cc1c(C)c(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C28H42O4/c1-8-9-10-13-20(2)14-11-15-21(3)16-12-17-22(4)18-19-24-23(5)25(29)27(31-6)28(32-7)26(24)30/h8-9,14,16,18,29-30H,10-13,15,17,19H2,1-7H3/b9-8-,20-14+,21-16-,22-18+ |
| InChIKey | SNWKNJWLDCTHJM-JXLPQEDNSA-N |
| XLogP | 7.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|