C20H30O4 — CID 164890062
2-[(2E,6E)-3,7-dimethylnona-2,6-dienyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol (PubChem CID 164890062) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7-dimethylnona-2,6-dienyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol.
| Compound Name | 2-[(2E,6E)-3,7-dimethylnona-2,6-dienyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 164890062 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-[(2E,6E)-3,7-dimethylnona-2,6-dienyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol |
| SMILES | CC/C(C)=C/CC/C(C)=C/Cc1c(C)c(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C20H30O4/c1-7-13(2)9-8-10-14(3)11-12-16-15(4)17(21)19(23-5)20(24-6)18(16)22/h9,11,21-22H,7-8,10,12H2,1-6H3/b13-9+,14-11+ |
| InChIKey | KIWJBVWGSOLLPZ-IJFRVEDASA-N |
| XLogP | 5.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|