C18H28O4 — CID 58954675
2-methoxy-6-methyl-5-[(E)-3-methylpent-2-enyl]-3-[(2-methylpropan-2-yl)oxy]benzene-1,4-diol (PubChem CID 58954675) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-methoxy-6-methyl-5-[(E)-3-methylpent-2-enyl]-3-[(2-methylpropan-2-yl)oxy]benzene-1,4-diol.
| Compound Name | 2-methoxy-6-methyl-5-[(E)-3-methylpent-2-enyl]-3-[(2-methylpropan-2-yl)oxy]benzene-1,4-diol |
|---|---|
| PubChem CID | 58954675 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-methoxy-6-methyl-5-[(E)-3-methylpent-2-enyl]-3-[(2-methylpropan-2-yl)oxy]benzene-1,4-diol |
| SMILES | CC/C(C)=C/Cc1c(C)c(O)c(OC)c(OC(C)(C)C)c1O |
| InChI | InChI=1S/C18H28O4/c1-8-11(2)9-10-13-12(3)14(19)16(21-7)17(15(13)20)22-18(4,5)6/h9,19-20H,8,10H2,1-7H3/b11-9+ |
| InChIKey | FXBFAIJDOLAXGN-PKNBQFBNSA-N |
| XLogP | 4.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|