About dioxomanganese;3-methyl-2-prop-2-enylphenol
dioxomanganese;3-methyl-2-prop-2-enylphenol (PubChem CID 175262810) has the molecular formula C10H12MnO3
and a molecular weight of 235.14 g/mol. Its IUPAC name is dioxomanganese;3-methyl-2-prop-2-enylphenol.
Molecular Properties
| Compound Name | dioxomanganese;3-methyl-2-prop-2-enylphenol |
| PubChem CID | 175262810 |
| Molecular Formula | C10H12MnO3 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | dioxomanganese;3-methyl-2-prop-2-enylphenol |
| SMILES | C=CCc1c(C)cccc1O.O=[Mn]=O |
| InChI | InChI=1S/C10H12O.Mn.2O/c1-3-5-9-8(2)6-4-7-10(9)11;;;/h3-4,6-7,11H,1,5H2,2H3;;; |
| InChIKey | GUGWDXITAHWBOQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dioxomanganese;3-methyl-2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomanganese;3-methyl-2-prop-2-enylphenol?
The IUPAC name of dioxomanganese;3-methyl-2-prop-2-enylphenol (CID 175262810) is dioxomanganese;3-methyl-2-prop-2-enylphenol.
What is the SMILES notation for dioxomanganese;3-methyl-2-prop-2-enylphenol?
The canonical SMILES for dioxomanganese;3-methyl-2-prop-2-enylphenol is C=CCc1c(C)cccc1O.O=[Mn]=O.
What is the InChIKey of dioxomanganese;3-methyl-2-prop-2-enylphenol?
The InChIKey is GUGWDXITAHWBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.Mn.2O/c1-3-5-9-8(2)6-4-7-10(9)11;;;/h3-4,6-7,11H,1,5H2,2H3;;;.
What are the key properties of dioxomanganese;3-methyl-2-prop-2-enylphenol?
dioxomanganese;3-methyl-2-prop-2-enylphenol has a molecular weight of 235.14 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomanganese;3-methyl-2-prop-2-enylphenol is sourced from PubChem (CID 175262810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).