C13H16O — CID 116659518
1-(2,6-dimethylphenyl)pent-4-en-2-one (PubChem CID 116659518) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)pent-4-en-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)pent-4-en-2-one |
|---|---|
| PubChem CID | 116659518 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-(2,6-dimethylphenyl)pent-4-en-2-one |
| SMILES | C=CCC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C13H16O/c1-4-6-12(14)9-13-10(2)7-5-8-11(13)3/h4-5,7-8H,1,6,9H2,2-3H3 |
| InChIKey | AMUXSAKHEIBJAM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|