C12H17NO — CID 116553750
1-(2,6-dimethylphenyl)-3-(methylamino)propan-2-one (PubChem CID 116553750) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(methylamino)propan-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(methylamino)propan-2-one |
|---|---|
| PubChem CID | 116553750 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(methylamino)propan-2-one |
| SMILES | CNCC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C12H17NO/c1-9-5-4-6-10(2)12(9)7-11(14)8-13-3/h4-6,13H,7-8H2,1-3H3 |
| InChIKey | CRBHRATYJAEINZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |