C15H22O2 — CID 105123511
1-(2,6-dimethylphenyl)-4-propoxybutan-2-one (PubChem CID 105123511) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-4-propoxybutan-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-4-propoxybutan-2-one |
|---|---|
| PubChem CID | 105123511 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-4-propoxybutan-2-one |
| SMILES | CCCOCCC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C15H22O2/c1-4-9-17-10-8-14(16)11-15-12(2)6-5-7-13(15)3/h5-7H,4,8-11H2,1-3H3 |
| InChIKey | AIFCDYWZHBOPMH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|