About 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one
1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one (PubChem CID 164986754) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one.
Molecular Properties
| Compound Name | 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one |
| PubChem CID | 164986754 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one |
| SMILES | CCCOCCOCCC(=O)Cc1ccc(CC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32O3/c1-5-11-22-13-14-23-12-10-19(21)15-17-6-8-18(9-7-17)16-20(2,3)4/h6-9H,5,10-16H2,1-4H3 |
| InChIKey | DFLIPYKJDFUUHV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one?
The IUPAC name of 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one (CID 164986754) is 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one.
What is the SMILES notation for 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one?
The canonical SMILES for 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one is CCCOCCOCCC(=O)Cc1ccc(CC(C)(C)C)cc1.
What is the InChIKey of 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one?
The InChIKey is DFLIPYKJDFUUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3/c1-5-11-22-13-14-23-12-10-19(21)15-17-6-8-18(9-7-17)16-20(2,3)4/h6-9H,5,10-16H2,1-4H3.
What are the key properties of 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one?
1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one has a molecular weight of 320.47 g/mol, XLogP of 4.22, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-dimethylpropyl)phenyl]-4-(2-propoxyethoxy)butan-2-one is sourced from PubChem (CID 164986754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).