C16H22O — CID 115792473
1-cyclopentyl-3-(2,6-dimethylphenyl)propan-2-one (PubChem CID 115792473) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,6-dimethylphenyl)propan-2-one.
| Compound Name | 1-cyclopentyl-3-(2,6-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 115792473 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1-cyclopentyl-3-(2,6-dimethylphenyl)propan-2-one |
| SMILES | Cc1cccc(C)c1CC(=O)CC1CCCC1 |
| InChI | InChI=1S/C16H22O/c1-12-6-5-7-13(2)16(12)11-15(17)10-14-8-3-4-9-14/h5-7,14H,3-4,8-11H2,1-2H3 |
| InChIKey | LGSRFCHWZPQDET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |