C17H23NO3 — CID 120684687
2-[1-[2-(2,6-dimethylphenyl)acetyl]piperidin-4-yl]acetic acid (PubChem CID 120684687) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[1-[2-(2,6-dimethylphenyl)acetyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[2-(2,6-dimethylphenyl)acetyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 120684687 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[1-[2-(2,6-dimethylphenyl)acetyl]piperidin-4-yl]acetic acid |
| SMILES | Cc1cccc(C)c1CC(=O)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H23NO3/c1-12-4-3-5-13(2)15(12)11-16(19)18-8-6-14(7-9-18)10-17(20)21/h3-5,14H,6-11H2,1-2H3,(H,20,21) |
| InChIKey | DRCOYEHULNVJLV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |