C20H29NO4 — CID 119178451
2-[1-[5-(2,5-dimethylphenoxy)pentanoyl]piperidin-4-yl]acetic acid (PubChem CID 119178451) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-[1-[5-(2,5-dimethylphenoxy)pentanoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[5-(2,5-dimethylphenoxy)pentanoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178451 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[1-[5-(2,5-dimethylphenoxy)pentanoyl]piperidin-4-yl]acetic acid |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N2CCC(CC(=O)O)CC2)c1 |
| InChI | InChI=1S/C20H29NO4/c1-15-6-7-16(2)18(13-15)25-12-4-3-5-19(22)21-10-8-17(9-11-21)14-20(23)24/h6-7,13,17H,3-5,8-12,14H2,1-2H3,(H,23,24) |
| InChIKey | HIWJDEJFHOJPIO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|