C15H22O3 — CID 39353078
7-(2,5-dimethylphenoxy)heptanoic acid (PubChem CID 39353078) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 7-(2,5-dimethylphenoxy)heptanoic acid.
| Compound Name | 7-(2,5-dimethylphenoxy)heptanoic acid |
|---|---|
| PubChem CID | 39353078 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 7-(2,5-dimethylphenoxy)heptanoic acid |
| SMILES | Cc1ccc(C)c(OCCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C15H22O3/c1-12-8-9-13(2)14(11-12)18-10-6-4-3-5-7-15(16)17/h8-9,11H,3-7,10H2,1-2H3,(H,16,17) |
| InChIKey | HRYJSMOUAMHSNJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|