C15H23N3O3 — CID 47897550
1-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylurea (PubChem CID 47897550) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylurea.
| Compound Name | 1-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylurea |
|---|---|
| PubChem CID | 47897550 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)CCCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C15H23N3O3/c1-11-7-8-12(2)13(10-11)21-9-5-4-6-14(19)17-18-15(20)16-3/h7-8,10H,4-6,9H2,1-3H3,(H,17,19)(H2,16,18,20) |
| InChIKey | JTKJMHKSAFGRRM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|